C35H38F2N2O4S — CID 157244366
(E)-4-[5-(4-butoxyphenyl)-2-(2,2-difluoroethoxy)phenyl]-1-[4-[(S)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one (PubChem CID 157244366) has the molecular formula C35H38F2N2O4S and a molecular weight of 620.76 g/mol. Its IUPAC name is (E)-4-[5-(4-butoxyphenyl)-2-(2,2-difluoroethoxy)phenyl]-1-[4-[(S)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one.
| Compound Name | (E)-4-[5-(4-butoxyphenyl)-2-(2,2-difluoroethoxy)phenyl]-1-[4-[(S)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 157244366 |
| Molecular Formula | C35H38F2N2O4S |
| Molecular Weight | 620.76 g/mol |
| Exact Mass | 620.25 |
| IUPAC Name | (E)-4-[5-(4-butoxyphenyl)-2-(2,2-difluoroethoxy)phenyl]-1-[4-[(S)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one |
| SMILES | CCCCOc1ccc(-c2ccc(OCC(F)F)c(/C=C/C(=O)Cc3ccc([S@@](=O)Cc4cncn4CCC)cc3)c2)cc1 |
| InChI | InChI=1S/C35H38F2N2O4S/c1-3-5-19-42-32-13-9-27(10-14-32)28-11-17-34(43-23-35(36)37)29(21-28)8-12-31(40)20-26-6-15-33(16-7-26)44(41)24-30-22-38-25-39(30)18-4-2/h6-17,21-22,25,35H,3-5,18-20,23-24H2,1-2H3/b12-8+/t44-/m0/s1 |
| InChIKey | OPKNFGMYTROTHL-RGOWIYTISA-N |
| XLogP | 7.92 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.76 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|