C37H44N2O6S — CID 158231221
(E)-4-[5-[4-(2-butoxyethoxy)phenyl]-2,3-dimethoxyphenyl]-1-[4-[(3-propylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one (PubChem CID 158231221) has the molecular formula C37H44N2O6S and a molecular weight of 644.83 g/mol. Its IUPAC name is (E)-4-[5-[4-(2-butoxyethoxy)phenyl]-2,3-dimethoxyphenyl]-1-[4-[(3-propylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one.
| Compound Name | (E)-4-[5-[4-(2-butoxyethoxy)phenyl]-2,3-dimethoxyphenyl]-1-[4-[(3-propylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 158231221 |
| Molecular Formula | C37H44N2O6S |
| Molecular Weight | 644.83 g/mol |
| Exact Mass | 644.29 |
| IUPAC Name | (E)-4-[5-[4-(2-butoxyethoxy)phenyl]-2,3-dimethoxyphenyl]-1-[4-[(3-propylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one |
| SMILES | CCCCOCCOc1ccc(-c2cc(/C=C/C(=O)Cc3ccc(S(=O)Cc4cncn4CCC)cc3)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C37H44N2O6S/c1-5-7-19-44-20-21-45-34-14-11-29(12-15-34)31-23-30(37(43-4)36(24-31)42-3)10-13-33(40)22-28-8-16-35(17-9-28)46(41)26-32-25-38-27-39(32)18-6-2/h8-17,23-25,27H,5-7,18-22,26H2,1-4H3/b13-10+ |
| InChIKey | RMGJGJARWCJXLP-JLHYYAGUSA-N |
| XLogP | 7.31 |
| TPSA | 88.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.83 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|