C36H43N3O6S — CID 154989365
(E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2,3-dimethoxyphenyl]-N-[4-[(R)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]prop-2-enamide (PubChem CID 154989365) has the molecular formula C36H43N3O6S and a molecular weight of 645.82 g/mol. Its IUPAC name is (E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2,3-dimethoxyphenyl]-N-[4-[(R)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2,3-dimethoxyphenyl]-N-[4-[(R)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 154989365 |
| Molecular Formula | C36H43N3O6S |
| Molecular Weight | 645.82 g/mol |
| Exact Mass | 645.29 |
| IUPAC Name | (E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2,3-dimethoxyphenyl]-N-[4-[(R)-(3-propylimidazol-4-yl)methylsulfinyl]phenyl]prop-2-enamide |
| SMILES | CCCCOCCOc1ccc(-c2cc(/C=C/C(=O)Nc3ccc([S@](=O)Cc4cncn4CCC)cc3)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C36H43N3O6S/c1-5-7-19-44-20-21-45-32-13-8-27(9-14-32)29-22-28(36(43-4)34(23-29)42-3)10-17-35(40)38-30-11-15-33(16-12-30)46(41)25-31-24-37-26-39(31)18-6-2/h8-17,22-24,26H,5-7,18-21,25H2,1-4H3,(H,38,40)/b17-10+/t46-/m1/s1 |
| InChIKey | ZHQKYGBFSNGCQZ-QKNVJUQKSA-N |
| XLogP | 7.13 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.82 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|