C36H43N3O5S — CID 146247090
(E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-methoxy-3-methylphenyl]-N-[4-[(S)-(3-ethyl-5-methylimidazol-4-yl)methylsulfinyl]phenyl]prop-2-enamide (PubChem CID 146247090) has the molecular formula C36H43N3O5S and a molecular weight of 629.82 g/mol. Its IUPAC name is (E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-methoxy-3-methylphenyl]-N-[4-[(S)-(3-ethyl-5-methylimidazol-4-yl)methylsulfinyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-methoxy-3-methylphenyl]-N-[4-[(S)-(3-ethyl-5-methylimidazol-4-yl)methylsulfinyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146247090 |
| Molecular Formula | C36H43N3O5S |
| Molecular Weight | 629.82 g/mol |
| Exact Mass | 629.29 |
| IUPAC Name | (E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-methoxy-3-methylphenyl]-N-[4-[(S)-(3-ethyl-5-methylimidazol-4-yl)methylsulfinyl]phenyl]prop-2-enamide |
| SMILES | CCCCOCCOc1ccc(-c2cc(C)c(OC)c(/C=C/C(=O)Nc3ccc([S@@](=O)Cc4c(C)ncn4CC)cc3)c2)cc1 |
| InChI | InChI=1S/C36H43N3O5S/c1-6-8-19-43-20-21-44-32-14-9-28(10-15-32)30-22-26(3)36(42-5)29(23-30)11-18-35(40)38-31-12-16-33(17-13-31)45(41)24-34-27(4)37-25-39(34)7-2/h9-18,22-23,25H,6-8,19-21,24H2,1-5H3,(H,38,40)/b18-11+/t45-/m0/s1 |
| InChIKey | QFGSLLNJAKDZCQ-XNLGYJTISA-N |
| XLogP | 7.35 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.82 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|