C40H48N2O4S — CID 157358135
(E)-4-[5-[4-(2-butoxyethoxy)phenyl]-2-cyclopentylphenyl]-1-[4-[(S)-(3-ethyl-5-methylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one (PubChem CID 157358135) has the molecular formula C40H48N2O4S and a molecular weight of 652.90 g/mol. Its IUPAC name is (E)-4-[5-[4-(2-butoxyethoxy)phenyl]-2-cyclopentylphenyl]-1-[4-[(S)-(3-ethyl-5-methylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one.
| Compound Name | (E)-4-[5-[4-(2-butoxyethoxy)phenyl]-2-cyclopentylphenyl]-1-[4-[(S)-(3-ethyl-5-methylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 157358135 |
| Molecular Formula | C40H48N2O4S |
| Molecular Weight | 652.90 g/mol |
| Exact Mass | 652.33 |
| IUPAC Name | (E)-4-[5-[4-(2-butoxyethoxy)phenyl]-2-cyclopentylphenyl]-1-[4-[(S)-(3-ethyl-5-methylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one |
| SMILES | CCCCOCCOc1ccc(-c2ccc(C3CCCC3)c(/C=C/C(=O)Cc3ccc([S@@](=O)Cc4c(C)ncn4CC)cc3)c2)cc1 |
| InChI | InChI=1S/C40H48N2O4S/c1-4-6-23-45-24-25-46-37-18-14-32(15-19-37)34-16-22-39(33-9-7-8-10-33)35(27-34)13-17-36(43)26-31-11-20-38(21-12-31)47(44)28-40-30(3)41-29-42(40)5-2/h11-22,27,29,33H,4-10,23-26,28H2,1-3H3/b17-13+/t47-/m0/s1 |
| InChIKey | RFRHQWOHDARYRE-VZMGJAGBSA-N |
| XLogP | 8.86 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.90 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|