C38H47N2O5S2+ — CID 158179812
(E)-4-[5-[4-(2-butoxyethoxy)phenyl]-2-propan-2-ylsulfinylphenyl]-1-[4-[(1-ethyl-3-methylimidazol-3-ium-2-yl)methylsulfinyl]phenyl]but-3-en-2-one (PubChem CID 158179812) has the molecular formula C38H47N2O5S2+ and a molecular weight of 675.94 g/mol. Its IUPAC name is (E)-4-[5-[4-(2-butoxyethoxy)phenyl]-2-propan-2-ylsulfinylphenyl]-1-[4-[(1-ethyl-3-methylimidazol-3-ium-2-yl)methylsulfinyl]phenyl]but-3-en-2-one.
| Compound Name | (E)-4-[5-[4-(2-butoxyethoxy)phenyl]-2-propan-2-ylsulfinylphenyl]-1-[4-[(1-ethyl-3-methylimidazol-3-ium-2-yl)methylsulfinyl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 158179812 |
| Molecular Formula | C38H47N2O5S2+ |
| Molecular Weight | 675.94 g/mol |
| Exact Mass | 675.29 |
| IUPAC Name | (E)-4-[5-[4-(2-butoxyethoxy)phenyl]-2-propan-2-ylsulfinylphenyl]-1-[4-[(1-ethyl-3-methylimidazol-3-ium-2-yl)methylsulfinyl]phenyl]but-3-en-2-one |
| SMILES | CCCCOCCOc1ccc(-c2ccc(S(=O)C(C)C)c(/C=C/C(=O)Cc3ccc(S(=O)Cc4n(CC)cc[n+]4C)cc3)c2)cc1 |
| InChI | InChI=1S/C38H47N2O5S2/c1-6-8-23-44-24-25-45-35-16-12-31(13-17-35)32-14-20-37(47(43)29(3)4)33(27-32)11-15-34(41)26-30-9-18-36(19-10-30)46(42)28-38-39(5)21-22-40(38)7-2/h9-22,27,29H,6-8,23-26,28H2,1-5H3/q+1/b15-11+ |
| InChIKey | BXWYCRAKMJMKES-RVDMUPIBSA-N |
| XLogP | 6.84 |
| TPSA | 78.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.94 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|