C36H39NO5S — CID 158179809
(E)-4-[5-[4-(2-butoxyethoxy)phenyl]-2-methoxyphenyl]-1-[4-[(4-methyl-3-pyridinyl)methylsulfinyl]phenyl]but-3-en-2-one (PubChem CID 158179809) has the molecular formula C36H39NO5S and a molecular weight of 597.78 g/mol. Its IUPAC name is (E)-4-[5-[4-(2-butoxyethoxy)phenyl]-2-methoxyphenyl]-1-[4-[(4-methyl-3-pyridinyl)methylsulfinyl]phenyl]but-3-en-2-one.
| Compound Name | (E)-4-[5-[4-(2-butoxyethoxy)phenyl]-2-methoxyphenyl]-1-[4-[(4-methyl-3-pyridinyl)methylsulfinyl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 158179809 |
| Molecular Formula | C36H39NO5S |
| Molecular Weight | 597.78 g/mol |
| Exact Mass | 597.25 |
| IUPAC Name | (E)-4-[5-[4-(2-butoxyethoxy)phenyl]-2-methoxyphenyl]-1-[4-[(4-methyl-3-pyridinyl)methylsulfinyl]phenyl]but-3-en-2-one |
| SMILES | CCCCOCCOc1ccc(-c2ccc(OC)c(/C=C/C(=O)Cc3ccc(S(=O)Cc4cnccc4C)cc3)c2)cc1 |
| InChI | InChI=1S/C36H39NO5S/c1-4-5-20-41-21-22-42-34-13-9-29(10-14-34)30-11-17-36(40-3)31(24-30)8-12-33(38)23-28-6-15-35(16-7-28)43(39)26-32-25-37-19-18-27(32)2/h6-19,24-25H,4-5,20-23,26H2,1-3H3/b12-8+ |
| InChIKey | JMQULGNNPYXPHA-XYOKQWHBSA-N |
| XLogP | 7.39 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.78 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|