C34H36F2N2O4S — CID 158295419
(E)-4-[5-(4-butoxyphenyl)-2-(difluoromethoxy)phenyl]-1-[4-[(3-propylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one (PubChem CID 158295419) has the molecular formula C34H36F2N2O4S and a molecular weight of 606.74 g/mol. Its IUPAC name is (E)-4-[5-(4-butoxyphenyl)-2-(difluoromethoxy)phenyl]-1-[4-[(3-propylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one.
| Compound Name | (E)-4-[5-(4-butoxyphenyl)-2-(difluoromethoxy)phenyl]-1-[4-[(3-propylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 158295419 |
| Molecular Formula | C34H36F2N2O4S |
| Molecular Weight | 606.74 g/mol |
| Exact Mass | 606.24 |
| IUPAC Name | (E)-4-[5-(4-butoxyphenyl)-2-(difluoromethoxy)phenyl]-1-[4-[(3-propylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one |
| SMILES | CCCCOc1ccc(-c2ccc(OC(F)F)c(/C=C/C(=O)Cc3ccc(S(=O)Cc4cncn4CCC)cc3)c2)cc1 |
| InChI | InChI=1S/C34H36F2N2O4S/c1-3-5-19-41-31-13-9-26(10-14-31)27-11-17-33(42-34(35)36)28(21-27)8-12-30(39)20-25-6-15-32(16-7-25)43(40)23-29-22-37-24-38(29)18-4-2/h6-17,21-22,24,34H,3-5,18-20,23H2,1-2H3/b12-8+ |
| InChIKey | VPTKAPCSQBOQEJ-XYOKQWHBSA-N |
| XLogP | 7.87 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.74 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|