C35H39FN2O4S — CID 157092106
(E)-4-[5-[4-(2-butoxyethoxy)phenyl]-2-fluorophenyl]-1-[4-[(R)-(3-ethyl-5-methylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one (PubChem CID 157092106) has the molecular formula C35H39FN2O4S and a molecular weight of 602.77 g/mol. Its IUPAC name is (E)-4-[5-[4-(2-butoxyethoxy)phenyl]-2-fluorophenyl]-1-[4-[(R)-(3-ethyl-5-methylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one.
| Compound Name | (E)-4-[5-[4-(2-butoxyethoxy)phenyl]-2-fluorophenyl]-1-[4-[(R)-(3-ethyl-5-methylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 157092106 |
| Molecular Formula | C35H39FN2O4S |
| Molecular Weight | 602.77 g/mol |
| Exact Mass | 602.26 |
| IUPAC Name | (E)-4-[5-[4-(2-butoxyethoxy)phenyl]-2-fluorophenyl]-1-[4-[(R)-(3-ethyl-5-methylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one |
| SMILES | CCCCOCCOc1ccc(-c2ccc(F)c(/C=C/C(=O)Cc3ccc([S@](=O)Cc4c(C)ncn4CC)cc3)c2)cc1 |
| InChI | InChI=1S/C35H39FN2O4S/c1-4-6-19-41-20-21-42-32-14-10-28(11-15-32)29-12-18-34(36)30(23-29)9-13-31(39)22-27-7-16-33(17-8-27)43(40)24-35-26(3)37-25-38(35)5-2/h7-18,23,25H,4-6,19-22,24H2,1-3H3/b13-9+/t43-/m1/s1 |
| InChIKey | QKMMMXUYOKMAOD-HHYIXCBZSA-N |
| XLogP | 7.35 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.77 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|