C35H38F3N3O4S — CID 146247196
(E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-(trifluoromethyl)phenyl]-N-[4-[(S)-(3-ethyl-5-methylimidazol-4-yl)methylsulfinyl]phenyl]prop-2-enamide (PubChem CID 146247196) has the molecular formula C35H38F3N3O4S and a molecular weight of 653.77 g/mol. Its IUPAC name is (E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-(trifluoromethyl)phenyl]-N-[4-[(S)-(3-ethyl-5-methylimidazol-4-yl)methylsulfinyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-(trifluoromethyl)phenyl]-N-[4-[(S)-(3-ethyl-5-methylimidazol-4-yl)methylsulfinyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146247196 |
| Molecular Formula | C35H38F3N3O4S |
| Molecular Weight | 653.77 g/mol |
| Exact Mass | 653.25 |
| IUPAC Name | (E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-(trifluoromethyl)phenyl]-N-[4-[(S)-(3-ethyl-5-methylimidazol-4-yl)methylsulfinyl]phenyl]prop-2-enamide |
| SMILES | CCCCOCCOc1ccc(-c2ccc(C(F)(F)F)c(/C=C/C(=O)Nc3ccc([S@@](=O)Cc4c(C)ncn4CC)cc3)c2)cc1 |
| InChI | InChI=1S/C35H38F3N3O4S/c1-4-6-19-44-20-21-45-30-13-7-26(8-14-30)27-9-17-32(35(36,37)38)28(22-27)10-18-34(42)40-29-11-15-31(16-12-29)46(43)23-33-25(3)39-24-41(33)5-2/h7-18,22,24H,4-6,19-21,23H2,1-3H3,(H,40,42)/b18-10+/t46-/m0/s1 |
| InChIKey | LNYGTDHSTOPHBY-FKRJGGMQSA-N |
| XLogP | 8.05 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.77 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|