C37H45N3O4S2 — CID 166924712
(E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-propan-2-ylsulfinylphenyl]-N-[4-[(3-ethyl-5-methylimidazol-4-yl)methylsulfanyl]phenyl]prop-2-enamide (PubChem CID 166924712) has the molecular formula C37H45N3O4S2 and a molecular weight of 659.92 g/mol. Its IUPAC name is (E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-propan-2-ylsulfinylphenyl]-N-[4-[(3-ethyl-5-methylimidazol-4-yl)methylsulfanyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-propan-2-ylsulfinylphenyl]-N-[4-[(3-ethyl-5-methylimidazol-4-yl)methylsulfanyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166924712 |
| Molecular Formula | C37H45N3O4S2 |
| Molecular Weight | 659.92 g/mol |
| Exact Mass | 659.29 |
| IUPAC Name | (E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-propan-2-ylsulfinylphenyl]-N-[4-[(3-ethyl-5-methylimidazol-4-yl)methylsulfanyl]phenyl]prop-2-enamide |
| SMILES | CCCCOCCOc1ccc(-c2ccc(S(=O)C(C)C)c(/C=C/C(=O)Nc3ccc(SCc4c(C)ncn4CC)cc3)c2)cc1 |
| InChI | InChI=1S/C37H45N3O4S2/c1-6-8-21-43-22-23-44-33-15-9-29(10-16-33)30-11-19-36(46(42)27(3)4)31(24-30)12-20-37(41)39-32-13-17-34(18-14-32)45-25-35-28(5)38-26-40(35)7-2/h9-20,24,26-27H,6-8,21-23,25H2,1-5H3,(H,39,41)/b20-12+ |
| InChIKey | NTQHGFFMOUCRGI-UDWIEESQSA-N |
| XLogP | 8.53 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.92 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|