C35H41N3O3S — CID 146247061
(E)-3-[3-[4-(2-butoxyethoxy)phenyl]phenyl]-N-[4-[[3-(2-methylpropyl)imidazol-4-yl]methylsulfanyl]phenyl]prop-2-enamide (PubChem CID 146247061) has the molecular formula C35H41N3O3S and a molecular weight of 583.80 g/mol. Its IUPAC name is (E)-3-[3-[4-(2-butoxyethoxy)phenyl]phenyl]-N-[4-[[3-(2-methylpropyl)imidazol-4-yl]methylsulfanyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-[3-[4-(2-butoxyethoxy)phenyl]phenyl]-N-[4-[[3-(2-methylpropyl)imidazol-4-yl]methylsulfanyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146247061 |
| Molecular Formula | C35H41N3O3S |
| Molecular Weight | 583.80 g/mol |
| Exact Mass | 583.29 |
| IUPAC Name | (E)-3-[3-[4-(2-butoxyethoxy)phenyl]phenyl]-N-[4-[[3-(2-methylpropyl)imidazol-4-yl]methylsulfanyl]phenyl]prop-2-enamide |
| SMILES | CCCCOCCOc1ccc(-c2cccc(/C=C/C(=O)Nc3ccc(SCc4cncn4CC(C)C)cc3)c2)cc1 |
| InChI | InChI=1S/C35H41N3O3S/c1-4-5-19-40-20-21-41-33-14-10-29(11-15-33)30-8-6-7-28(22-30)9-18-35(39)37-31-12-16-34(17-13-31)42-25-32-23-36-26-38(32)24-27(2)3/h6-18,22-23,26-27H,4-5,19-21,24-25H2,1-3H3,(H,37,39)/b18-9+ |
| InChIKey | XFVGQMJWSRNRHL-GIJQJNRQSA-N |
| XLogP | 8.35 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.80 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|