C35H43N3O4S — CID 166924793
(E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-methoxycyclohexa-1,5-dien-1-yl]-N-[4-[(3-propylimidazol-4-yl)methylsulfanyl]phenyl]prop-2-enamide (PubChem CID 166924793) has the molecular formula C35H43N3O4S and a molecular weight of 601.81 g/mol. Its IUPAC name is (E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-methoxycyclohexa-1,5-dien-1-yl]-N-[4-[(3-propylimidazol-4-yl)methylsulfanyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-methoxycyclohexa-1,5-dien-1-yl]-N-[4-[(3-propylimidazol-4-yl)methylsulfanyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166924793 |
| Molecular Formula | C35H43N3O4S |
| Molecular Weight | 601.81 g/mol |
| Exact Mass | 601.30 |
| IUPAC Name | (E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-methoxycyclohexa-1,5-dien-1-yl]-N-[4-[(3-propylimidazol-4-yl)methylsulfanyl]phenyl]prop-2-enamide |
| SMILES | CCCCOCCOc1ccc(C2=CC(/C=C/C(=O)Nc3ccc(SCc4cncn4CCC)cc3)=C(OC)CC2)cc1 |
| InChI | InChI=1S/C35H43N3O4S/c1-4-6-20-41-21-22-42-32-13-7-27(8-14-32)28-9-17-34(40-3)29(23-28)10-18-35(39)37-30-11-15-33(16-12-30)43-25-31-24-36-26-38(31)19-5-2/h7-8,10-16,18,23-24,26H,4-6,9,17,19-22,25H2,1-3H3,(H,37,39)/b18-10+ |
| InChIKey | WAZRAAAICRXSOB-VCHYOVAHSA-N |
| XLogP | 8.05 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.81 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|