C33H37N3O3S — CID 146247137
(E)-3-[5-(4-butoxyphenyl)-2-methoxyphenyl]-N-[4-[(3-propylimidazol-4-yl)methylsulfanyl]phenyl]prop-2-enamide (PubChem CID 146247137) has the molecular formula C33H37N3O3S and a molecular weight of 555.74 g/mol. Its IUPAC name is (E)-3-[5-(4-butoxyphenyl)-2-methoxyphenyl]-N-[4-[(3-propylimidazol-4-yl)methylsulfanyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(4-butoxyphenyl)-2-methoxyphenyl]-N-[4-[(3-propylimidazol-4-yl)methylsulfanyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146247137 |
| Molecular Formula | C33H37N3O3S |
| Molecular Weight | 555.74 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | (E)-3-[5-(4-butoxyphenyl)-2-methoxyphenyl]-N-[4-[(3-propylimidazol-4-yl)methylsulfanyl]phenyl]prop-2-enamide |
| SMILES | CCCCOc1ccc(-c2ccc(OC)c(/C=C/C(=O)Nc3ccc(SCc4cncn4CCC)cc3)c2)cc1 |
| InChI | InChI=1S/C33H37N3O3S/c1-4-6-20-39-30-13-7-25(8-14-30)26-9-17-32(38-3)27(21-26)10-18-33(37)35-28-11-15-31(16-12-28)40-23-29-22-34-24-36(29)19-5-2/h7-18,21-22,24H,4-6,19-20,23H2,1-3H3,(H,35,37)/b18-10+ |
| InChIKey | QHHNBRVZBLENJY-VCHYOVAHSA-N |
| XLogP | 8.09 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.74 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|