C33H36FN3O3S — CID 166924675
(E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-fluorophenyl]-N-[4-(3-propylimidazol-4-yl)sulfanylphenyl]prop-2-enamide (PubChem CID 166924675) has the molecular formula C33H36FN3O3S and a molecular weight of 573.73 g/mol. Its IUPAC name is (E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-fluorophenyl]-N-[4-(3-propylimidazol-4-yl)sulfanylphenyl]prop-2-enamide.
| Compound Name | (E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-fluorophenyl]-N-[4-(3-propylimidazol-4-yl)sulfanylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166924675 |
| Molecular Formula | C33H36FN3O3S |
| Molecular Weight | 573.73 g/mol |
| Exact Mass | 573.25 |
| IUPAC Name | (E)-3-[5-[4-(2-butoxyethoxy)phenyl]-2-fluorophenyl]-N-[4-(3-propylimidazol-4-yl)sulfanylphenyl]prop-2-enamide |
| SMILES | CCCCOCCOc1ccc(-c2ccc(F)c(/C=C/C(=O)Nc3ccc(Sc4cncn4CCC)cc3)c2)cc1 |
| InChI | InChI=1S/C33H36FN3O3S/c1-3-5-19-39-20-21-40-29-12-6-25(7-13-29)26-8-16-31(34)27(22-26)9-17-32(38)36-28-10-14-30(15-11-28)41-33-23-35-24-37(33)18-4-2/h6-17,22-24H,3-5,18-21H2,1-2H3,(H,36,38)/b17-9+ |
| InChIKey | XSPMEAKAWIBJIA-RQZCQDPDSA-N |
| XLogP | 8.10 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.73 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|