C34H39N3O4S — CID 146246996
(E)-3-[2-methoxy-5-[4-(2-propoxyethoxy)phenyl]phenyl]-N-[4-[(3-propylimidazol-4-yl)methylsulfanyl]phenyl]prop-2-enamide (PubChem CID 146246996) has the molecular formula C34H39N3O4S and a molecular weight of 585.77 g/mol. Its IUPAC name is (E)-3-[2-methoxy-5-[4-(2-propoxyethoxy)phenyl]phenyl]-N-[4-[(3-propylimidazol-4-yl)methylsulfanyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-[2-methoxy-5-[4-(2-propoxyethoxy)phenyl]phenyl]-N-[4-[(3-propylimidazol-4-yl)methylsulfanyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146246996 |
| Molecular Formula | C34H39N3O4S |
| Molecular Weight | 585.77 g/mol |
| Exact Mass | 585.27 |
| IUPAC Name | (E)-3-[2-methoxy-5-[4-(2-propoxyethoxy)phenyl]phenyl]-N-[4-[(3-propylimidazol-4-yl)methylsulfanyl]phenyl]prop-2-enamide |
| SMILES | CCCOCCOc1ccc(-c2ccc(OC)c(/C=C/C(=O)Nc3ccc(SCc4cncn4CCC)cc3)c2)cc1 |
| InChI | InChI=1S/C34H39N3O4S/c1-4-18-37-25-35-23-30(37)24-42-32-14-10-29(11-15-32)36-34(38)17-9-28-22-27(8-16-33(28)39-3)26-6-12-31(13-7-26)41-21-20-40-19-5-2/h6-17,22-23,25H,4-5,18-21,24H2,1-3H3,(H,36,38)/b17-9+ |
| InChIKey | INSAAZZVXZATBO-RQZCQDPDSA-N |
| XLogP | 7.72 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.77 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|