C34H39N3O5S — CID 146247000
(E)-3-[3-[4-(2-butoxyethoxy)phenyl]phenyl]-N-[4-[(3-propylimidazol-4-yl)methylsulfonyl]phenyl]prop-2-enamide (PubChem CID 146247000) has the molecular formula C34H39N3O5S and a molecular weight of 601.77 g/mol. Its IUPAC name is (E)-3-[3-[4-(2-butoxyethoxy)phenyl]phenyl]-N-[4-[(3-propylimidazol-4-yl)methylsulfonyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-[3-[4-(2-butoxyethoxy)phenyl]phenyl]-N-[4-[(3-propylimidazol-4-yl)methylsulfonyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146247000 |
| Molecular Formula | C34H39N3O5S |
| Molecular Weight | 601.77 g/mol |
| Exact Mass | 601.26 |
| IUPAC Name | (E)-3-[3-[4-(2-butoxyethoxy)phenyl]phenyl]-N-[4-[(3-propylimidazol-4-yl)methylsulfonyl]phenyl]prop-2-enamide |
| SMILES | CCCCOCCOc1ccc(-c2cccc(/C=C/C(=O)Nc3ccc(S(=O)(=O)Cc4cncn4CCC)cc3)c2)cc1 |
| InChI | InChI=1S/C34H39N3O5S/c1-3-5-20-41-21-22-42-32-14-10-28(11-15-32)29-8-6-7-27(23-29)9-18-34(38)36-30-12-16-33(17-13-30)43(39,40)25-31-24-35-26-37(31)19-4-2/h6-18,23-24,26H,3-5,19-22,25H2,1-2H3,(H,36,38)/b18-9+ |
| InChIKey | SIDWGLWSBKFJFX-GIJQJNRQSA-N |
| XLogP | 6.78 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.77 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|