C33H38N4O4S — CID 154989392
(E)-3-[3-[4-(2-butoxyethoxy)phenyl]phenyl]-N-[4-[(R)-(4-propyl-1,2,4-triazol-3-yl)methylsulfinyl]phenyl]prop-2-enamide (PubChem CID 154989392) has the molecular formula C33H38N4O4S and a molecular weight of 586.76 g/mol. Its IUPAC name is (E)-3-[3-[4-(2-butoxyethoxy)phenyl]phenyl]-N-[4-[(R)-(4-propyl-1,2,4-triazol-3-yl)methylsulfinyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-[3-[4-(2-butoxyethoxy)phenyl]phenyl]-N-[4-[(R)-(4-propyl-1,2,4-triazol-3-yl)methylsulfinyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 154989392 |
| Molecular Formula | C33H38N4O4S |
| Molecular Weight | 586.76 g/mol |
| Exact Mass | 586.26 |
| IUPAC Name | (E)-3-[3-[4-(2-butoxyethoxy)phenyl]phenyl]-N-[4-[(R)-(4-propyl-1,2,4-triazol-3-yl)methylsulfinyl]phenyl]prop-2-enamide |
| SMILES | CCCCOCCOc1ccc(-c2cccc(/C=C/C(=O)Nc3ccc([S@](=O)Cc4nncn4CCC)cc3)c2)cc1 |
| InChI | InChI=1S/C33H38N4O4S/c1-3-5-20-40-21-22-41-30-14-10-27(11-15-30)28-8-6-7-26(23-28)9-18-33(38)35-29-12-16-31(17-13-29)42(39)24-32-36-34-25-37(32)19-4-2/h6-18,23,25H,3-5,19-22,24H2,1-2H3,(H,35,38)/b18-9+/t42-/m1/s1 |
| InChIKey | QFSLZADMRXGXCK-SFUAJZAKSA-N |
| XLogP | 6.51 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.76 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|