C36H41FN2O5S — CID 158178844
(E)-4-[5-[4-(2-butoxyethoxy)phenyl]-3-fluoro-2-methoxyphenyl]-1-[4-[(S)-(3-ethyl-5-methylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one (PubChem CID 158178844) has the molecular formula C36H41FN2O5S and a molecular weight of 632.80 g/mol. Its IUPAC name is (E)-4-[5-[4-(2-butoxyethoxy)phenyl]-3-fluoro-2-methoxyphenyl]-1-[4-[(S)-(3-ethyl-5-methylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one.
| Compound Name | (E)-4-[5-[4-(2-butoxyethoxy)phenyl]-3-fluoro-2-methoxyphenyl]-1-[4-[(S)-(3-ethyl-5-methylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 158178844 |
| Molecular Formula | C36H41FN2O5S |
| Molecular Weight | 632.80 g/mol |
| Exact Mass | 632.27 |
| IUPAC Name | (E)-4-[5-[4-(2-butoxyethoxy)phenyl]-3-fluoro-2-methoxyphenyl]-1-[4-[(S)-(3-ethyl-5-methylimidazol-4-yl)methylsulfinyl]phenyl]but-3-en-2-one |
| SMILES | CCCCOCCOc1ccc(-c2cc(F)c(OC)c(/C=C/C(=O)Cc3ccc([S@@](=O)Cc4c(C)ncn4CC)cc3)c2)cc1 |
| InChI | InChI=1S/C36H41FN2O5S/c1-5-7-18-43-19-20-44-32-14-11-28(12-15-32)30-22-29(36(42-4)34(37)23-30)10-13-31(40)21-27-8-16-33(17-9-27)45(41)24-35-26(3)38-25-39(35)6-2/h8-17,22-23,25H,5-7,18-21,24H2,1-4H3/b13-10+/t45-/m0/s1 |
| InChIKey | YSZAGGUBCUVXFX-QLELCVEJSA-N |
| XLogP | 7.35 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.80 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|