C24H27NO4 — CID 22329149
methyl 7-[4-(2-butoxyethoxy)phenyl]-1H-1-benzazepine-4-carboxylate (PubChem CID 22329149) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is methyl 7-[4-(2-butoxyethoxy)phenyl]-1H-1-benzazepine-4-carboxylate.
| Compound Name | methyl 7-[4-(2-butoxyethoxy)phenyl]-1H-1-benzazepine-4-carboxylate |
|---|---|
| PubChem CID | 22329149 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | methyl 7-[4-(2-butoxyethoxy)phenyl]-1H-1-benzazepine-4-carboxylate |
| SMILES | CCCCOCCOc1ccc(-c2ccc3c(c2)C=C(C(=O)OC)C=CN3)cc1 |
| InChI | InChI=1S/C24H27NO4/c1-3-4-13-28-14-15-29-22-8-5-18(6-9-22)19-7-10-23-21(16-19)17-20(11-12-25-23)24(26)27-2/h5-12,16-17,25H,3-4,13-15H2,1-2H3 |
| InChIKey | AODQRQQCNURSPQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|