C25H31NO6S — CID 22938394
methyl 7-[4-(2-butoxyethoxy)phenyl]-1-methylsulfonyl-2,3-dihydro-1-benzazepine-4-carboxylate (PubChem CID 22938394) has the molecular formula C25H31NO6S and a molecular weight of 473.59 g/mol. Its IUPAC name is methyl 7-[4-(2-butoxyethoxy)phenyl]-1-methylsulfonyl-2,3-dihydro-1-benzazepine-4-carboxylate.
| Compound Name | methyl 7-[4-(2-butoxyethoxy)phenyl]-1-methylsulfonyl-2,3-dihydro-1-benzazepine-4-carboxylate |
|---|---|
| PubChem CID | 22938394 |
| Molecular Formula | C25H31NO6S |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | methyl 7-[4-(2-butoxyethoxy)phenyl]-1-methylsulfonyl-2,3-dihydro-1-benzazepine-4-carboxylate |
| SMILES | CCCCOCCOc1ccc(-c2ccc3c(c2)C=C(C(=O)OC)CCN3S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C25H31NO6S/c1-4-5-14-31-15-16-32-23-9-6-19(7-10-23)20-8-11-24-22(17-20)18-21(25(27)30-2)12-13-26(24)33(3,28)29/h6-11,17-18H,4-5,12-16H2,1-3H3 |
| InChIKey | YCBAYSIVJRBQDS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|