C23H27NO6S — CID 22329233
1-methylsulfonyl-7-[4-(2-propan-2-yloxyethoxy)phenyl]-2,3-dihydro-1-benzazepine-4-carboxylic acid (PubChem CID 22329233) has the molecular formula C23H27NO6S and a molecular weight of 445.54 g/mol. Its IUPAC name is 1-methylsulfonyl-7-[4-(2-propan-2-yloxyethoxy)phenyl]-2,3-dihydro-1-benzazepine-4-carboxylic acid.
| Compound Name | 1-methylsulfonyl-7-[4-(2-propan-2-yloxyethoxy)phenyl]-2,3-dihydro-1-benzazepine-4-carboxylic acid |
|---|---|
| PubChem CID | 22329233 |
| Molecular Formula | C23H27NO6S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 1-methylsulfonyl-7-[4-(2-propan-2-yloxyethoxy)phenyl]-2,3-dihydro-1-benzazepine-4-carboxylic acid |
| SMILES | CC(C)OCCOc1ccc(-c2ccc3c(c2)C=C(C(=O)O)CCN3S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C23H27NO6S/c1-16(2)29-12-13-30-21-7-4-17(5-8-21)18-6-9-22-20(14-18)15-19(23(25)26)10-11-24(22)31(3,27)28/h4-9,14-16H,10-13H2,1-3H3,(H,25,26) |
| InChIKey | XWOLQXPUPMVRQX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|