C21H21NO4S — CID 22328914
1-formyl-7-[4-(2-methylsulfanylethoxy)phenyl]-2,3-dihydro-1-benzazepine-4-carboxylic acid (PubChem CID 22328914) has the molecular formula C21H21NO4S and a molecular weight of 383.47 g/mol. Its IUPAC name is 1-formyl-7-[4-(2-methylsulfanylethoxy)phenyl]-2,3-dihydro-1-benzazepine-4-carboxylic acid.
| Compound Name | 1-formyl-7-[4-(2-methylsulfanylethoxy)phenyl]-2,3-dihydro-1-benzazepine-4-carboxylic acid |
|---|---|
| PubChem CID | 22328914 |
| Molecular Formula | C21H21NO4S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 1-formyl-7-[4-(2-methylsulfanylethoxy)phenyl]-2,3-dihydro-1-benzazepine-4-carboxylic acid |
| SMILES | CSCCOc1ccc(-c2ccc3c(c2)C=C(C(=O)O)CCN3C=O)cc1 |
| InChI | InChI=1S/C21H21NO4S/c1-27-11-10-26-19-5-2-15(3-6-19)16-4-7-20-18(12-16)13-17(21(24)25)8-9-22(20)14-23/h2-7,12-14H,8-11H2,1H3,(H,24,25) |
| InChIKey | JUSNITOGXQLJQM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|