C36H43N3O5 — CID 87979040
1-formyl-N-[4-[[methyl(oxan-4-yl)amino]methyl]phenyl]-7-[4-(1-propoxyethoxy)phenyl]-2,3-dihydro-1-benzazepine-4-carboxamide (PubChem CID 87979040) has the molecular formula C36H43N3O5 and a molecular weight of 597.76 g/mol. Its IUPAC name is 1-formyl-N-[4-[[methyl(oxan-4-yl)amino]methyl]phenyl]-7-[4-(1-propoxyethoxy)phenyl]-2,3-dihydro-1-benzazepine-4-carboxamide.
| Compound Name | 1-formyl-N-[4-[[methyl(oxan-4-yl)amino]methyl]phenyl]-7-[4-(1-propoxyethoxy)phenyl]-2,3-dihydro-1-benzazepine-4-carboxamide |
|---|---|
| PubChem CID | 87979040 |
| Molecular Formula | C36H43N3O5 |
| Molecular Weight | 597.76 g/mol |
| Exact Mass | 597.32 |
| IUPAC Name | 1-formyl-N-[4-[[methyl(oxan-4-yl)amino]methyl]phenyl]-7-[4-(1-propoxyethoxy)phenyl]-2,3-dihydro-1-benzazepine-4-carboxamide |
| SMILES | CCCOC(C)Oc1ccc(-c2ccc3c(c2)C=C(C(=O)Nc2ccc(CN(C)C4CCOCC4)cc2)CCN3C=O)cc1 |
| InChI | InChI=1S/C36H43N3O5/c1-4-19-43-26(2)44-34-12-7-28(8-13-34)29-9-14-35-31(22-29)23-30(15-18-39(35)25-40)36(41)37-32-10-5-27(6-11-32)24-38(3)33-16-20-42-21-17-33/h5-14,22-23,25-26,33H,4,15-21,24H2,1-3H3,(H,37,41) |
| InChIKey | ZQOKQMHLFVOHHL-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.76 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|