C29H35N3O4 — CID 22329267
methyl 7-[4-(1-butoxyethoxy)phenyl]-1-[(2-methylpyrazol-3-yl)methyl]-2,3-dihydro-1-benzazepine-4-carboxylate (PubChem CID 22329267) has the molecular formula C29H35N3O4 and a molecular weight of 489.62 g/mol. Its IUPAC name is methyl 7-[4-(1-butoxyethoxy)phenyl]-1-[(2-methylpyrazol-3-yl)methyl]-2,3-dihydro-1-benzazepine-4-carboxylate.
| Compound Name | methyl 7-[4-(1-butoxyethoxy)phenyl]-1-[(2-methylpyrazol-3-yl)methyl]-2,3-dihydro-1-benzazepine-4-carboxylate |
|---|---|
| PubChem CID | 22329267 |
| Molecular Formula | C29H35N3O4 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | methyl 7-[4-(1-butoxyethoxy)phenyl]-1-[(2-methylpyrazol-3-yl)methyl]-2,3-dihydro-1-benzazepine-4-carboxylate |
| SMILES | CCCCOC(C)Oc1ccc(-c2ccc3c(c2)C=C(C(=O)OC)CCN3Cc2ccnn2C)cc1 |
| InChI | InChI=1S/C29H35N3O4/c1-5-6-17-35-21(2)36-27-10-7-22(8-11-27)23-9-12-28-25(18-23)19-24(29(33)34-4)14-16-32(28)20-26-13-15-30-31(26)3/h7-13,15,18-19,21H,5-6,14,16-17,20H2,1-4H3 |
| InChIKey | ZLYHDONPCZHMBC-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|