C24H31NO3 — CID 155204956
[(5E)-8-[4-(2-butoxyethoxy)phenyl]-1,2,3,4-tetrahydro-1-benzazocin-5-yl]methanol (PubChem CID 155204956) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is [(5E)-8-[4-(2-butoxyethoxy)phenyl]-1,2,3,4-tetrahydro-1-benzazocin-5-yl]methanol.
| Compound Name | [(5E)-8-[4-(2-butoxyethoxy)phenyl]-1,2,3,4-tetrahydro-1-benzazocin-5-yl]methanol |
|---|---|
| PubChem CID | 155204956 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | [(5E)-8-[4-(2-butoxyethoxy)phenyl]-1,2,3,4-tetrahydro-1-benzazocin-5-yl]methanol |
| SMILES | CCCCOCCOc1ccc(-c2ccc3c(c2)/C=C(/CO)CCCN3)cc1 |
| InChI | InChI=1S/C24H31NO3/c1-2-3-13-27-14-15-28-23-9-6-20(7-10-23)21-8-11-24-22(17-21)16-19(18-26)5-4-12-25-24/h6-11,16-17,25-26H,2-5,12-15,18H2,1H3/b19-16+ |
| InChIKey | YYPOMUVSDYFCSA-KNTRCKAVSA-N |
| XLogP | 5.13 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|