C29H36NO5+ — CID 91015196
methyl 1-benzyl-8-[4-(2-butoxyethoxy)phenyl]-1-formyl-3,4-dihydro-2H-azocin-1-ium-5-carboxylate (PubChem CID 91015196) has the molecular formula C29H36NO5+ and a molecular weight of 478.61 g/mol. Its IUPAC name is methyl 1-benzyl-8-[4-(2-butoxyethoxy)phenyl]-1-formyl-3,4-dihydro-2H-azocin-1-ium-5-carboxylate.
| Compound Name | methyl 1-benzyl-8-[4-(2-butoxyethoxy)phenyl]-1-formyl-3,4-dihydro-2H-azocin-1-ium-5-carboxylate |
|---|---|
| PubChem CID | 91015196 |
| Molecular Formula | C29H36NO5+ |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | methyl 1-benzyl-8-[4-(2-butoxyethoxy)phenyl]-1-formyl-3,4-dihydro-2H-azocin-1-ium-5-carboxylate |
| SMILES | CCCCOCCOc1ccc(C2=CC=C(C(=O)OC)CCC[N+]2(C=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C29H36NO5/c1-3-4-19-34-20-21-35-27-15-12-25(13-16-27)28-17-14-26(29(32)33-2)11-8-18-30(28,23-31)22-24-9-6-5-7-10-24/h5-7,9-10,12-17,23H,3-4,8,11,18-22H2,1-2H3/q+1 |
| InChIKey | IWJLFQCTMUUGTN-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|