C32H42NO4+ — CID 91500401
methyl 1-benzyl-8-[4-(2-butoxyethoxy)phenyl]-1-(2-methylprop-2-enyl)-3,4-dihydro-2H-azocin-1-ium-5-carboxylate (PubChem CID 91500401) has the molecular formula C32H42NO4+ and a molecular weight of 504.69 g/mol. Its IUPAC name is methyl 1-benzyl-8-[4-(2-butoxyethoxy)phenyl]-1-(2-methylprop-2-enyl)-3,4-dihydro-2H-azocin-1-ium-5-carboxylate.
| Compound Name | methyl 1-benzyl-8-[4-(2-butoxyethoxy)phenyl]-1-(2-methylprop-2-enyl)-3,4-dihydro-2H-azocin-1-ium-5-carboxylate |
|---|---|
| PubChem CID | 91500401 |
| Molecular Formula | C32H42NO4+ |
| Molecular Weight | 504.69 g/mol |
| Exact Mass | 504.31 |
| IUPAC Name | methyl 1-benzyl-8-[4-(2-butoxyethoxy)phenyl]-1-(2-methylprop-2-enyl)-3,4-dihydro-2H-azocin-1-ium-5-carboxylate |
| SMILES | C=C(C)C[N+]1(Cc2ccccc2)CCCC(C(=O)OC)=CC=C1c1ccc(OCCOCCCC)cc1 |
| InChI | InChI=1S/C32H42NO4/c1-5-6-21-36-22-23-37-30-17-14-28(15-18-30)31-19-16-29(32(34)35-4)13-10-20-33(31,24-26(2)3)25-27-11-8-7-9-12-27/h7-9,11-12,14-19H,2,5-6,10,13,20-25H2,1,3-4H3/q+1 |
| InChIKey | JREKNJOLBCQZGB-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.69 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|