C42H53N4O5S+ — CID 90739414
8-[4-(2-butoxyethoxy)phenyl]-1-phenyl-1-propyl-N-[4-[(3-propylimidazol-4-yl)methylsulfonyl]phenyl]-3,4-dihydro-2H-azocin-1-ium-5-carboxamide (PubChem CID 90739414) has the molecular formula C42H53N4O5S+ and a molecular weight of 725.98 g/mol. Its IUPAC name is 8-[4-(2-butoxyethoxy)phenyl]-1-phenyl-1-propyl-N-[4-[(3-propylimidazol-4-yl)methylsulfonyl]phenyl]-3,4-dihydro-2H-azocin-1-ium-5-carboxamide.
| Compound Name | 8-[4-(2-butoxyethoxy)phenyl]-1-phenyl-1-propyl-N-[4-[(3-propylimidazol-4-yl)methylsulfonyl]phenyl]-3,4-dihydro-2H-azocin-1-ium-5-carboxamide |
|---|---|
| PubChem CID | 90739414 |
| Molecular Formula | C42H53N4O5S+ |
| Molecular Weight | 725.98 g/mol |
| Exact Mass | 725.37 |
| IUPAC Name | 8-[4-(2-butoxyethoxy)phenyl]-1-phenyl-1-propyl-N-[4-[(3-propylimidazol-4-yl)methylsulfonyl]phenyl]-3,4-dihydro-2H-azocin-1-ium-5-carboxamide |
| SMILES | CCCCOCCOc1ccc(C2=CC=C(C(=O)Nc3ccc(S(=O)(=O)Cc4cncn4CCC)cc3)CCC[N+]2(CCC)c2ccccc2)cc1 |
| InChI | InChI=1S/C42H52N4O5S/c1-4-7-28-50-29-30-51-39-20-15-34(16-21-39)41-24-17-35(12-11-27-46(41,26-6-3)38-13-9-8-10-14-38)42(47)44-36-18-22-40(23-19-36)52(48,49)32-37-31-43-33-45(37)25-5-2/h8-10,13-24,31,33H,4-7,11-12,25-30,32H2,1-3H3/p+1 |
| InChIKey | LBZQZZTVWIPDCJ-UHFFFAOYSA-O |
| XLogP | 8.58 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.98 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|