C19H25BrNO2+ — CID 90873562
methyl 8-bromo-1-(2-methylpropyl)-1-phenyl-3,4-dihydro-2H-azocin-1-ium-5-carboxylate (PubChem CID 90873562) has the molecular formula C19H25BrNO2+ and a molecular weight of 379.32 g/mol. Its IUPAC name is methyl 8-bromo-1-(2-methylpropyl)-1-phenyl-3,4-dihydro-2H-azocin-1-ium-5-carboxylate.
| Compound Name | methyl 8-bromo-1-(2-methylpropyl)-1-phenyl-3,4-dihydro-2H-azocin-1-ium-5-carboxylate |
|---|---|
| PubChem CID | 90873562 |
| Molecular Formula | C19H25BrNO2+ |
| Molecular Weight | 379.32 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | methyl 8-bromo-1-(2-methylpropyl)-1-phenyl-3,4-dihydro-2H-azocin-1-ium-5-carboxylate |
| SMILES | COC(=O)C1=CC=C(Br)[N+](CC(C)C)(c2ccccc2)CCC1 |
| InChI | InChI=1S/C19H25BrNO2/c1-15(2)14-21(17-9-5-4-6-10-17)13-7-8-16(19(22)23-3)11-12-18(21)20/h4-6,9-12,15H,7-8,13-14H2,1-3H3/q+1 |
| InChIKey | WGTBSOUCCASJSR-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.32 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|