C10H14FNO2 — CID 143665533
2-(4-fluoro-5-methylcyclohexa-1,3-dien-1-yl)-N-methoxyacetamide (PubChem CID 143665533) has the molecular formula C10H14FNO2 and a molecular weight of 199.22 g/mol. Its IUPAC name is 2-(4-fluoro-5-methylcyclohexa-1,3-dien-1-yl)-N-methoxyacetamide.
| Compound Name | 2-(4-fluoro-5-methylcyclohexa-1,3-dien-1-yl)-N-methoxyacetamide |
|---|---|
| PubChem CID | 143665533 |
| Molecular Formula | C10H14FNO2 |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 2-(4-fluoro-5-methylcyclohexa-1,3-dien-1-yl)-N-methoxyacetamide |
| SMILES | CONC(=O)CC1=CC=C(F)C(C)C1 |
| InChI | InChI=1S/C10H14FNO2/c1-7-5-8(3-4-9(7)11)6-10(13)12-14-2/h3-4,7H,5-6H2,1-2H3,(H,12,13) |
| InChIKey | MCFAZOBILPNUDV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|