C21H36N6O9 — CID 90074306
5-[[4,6-bis[5-(methoxyamino)-5-oxopentoxy]-1,3,5-triazin-2-yl]oxy]-N-methoxypentanamide (PubChem CID 90074306) has the molecular formula C21H36N6O9 and a molecular weight of 516.55 g/mol. Its IUPAC name is 5-[[4,6-bis[5-(methoxyamino)-5-oxopentoxy]-1,3,5-triazin-2-yl]oxy]-N-methoxypentanamide.
| Compound Name | 5-[[4,6-bis[5-(methoxyamino)-5-oxopentoxy]-1,3,5-triazin-2-yl]oxy]-N-methoxypentanamide |
|---|---|
| PubChem CID | 90074306 |
| Molecular Formula | C21H36N6O9 |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | 5-[[4,6-bis[5-(methoxyamino)-5-oxopentoxy]-1,3,5-triazin-2-yl]oxy]-N-methoxypentanamide |
| SMILES | CONC(=O)CCCCOc1nc(OCCCCC(=O)NOC)nc(OCCCCC(=O)NOC)n1 |
| InChI | InChI=1S/C21H36N6O9/c1-31-25-16(28)10-4-7-13-34-19-22-20(35-14-8-5-11-17(29)26-32-2)24-21(23-19)36-15-9-6-12-18(30)27-33-3/h4-15H2,1-3H3,(H,25,28)(H,26,29)(H,27,30) |
| InChIKey | OUYDMFIFLWUGLF-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 181.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|