C18H30N4O6 — CID 90073888
N-methoxy-6-[2-[6-(methoxyamino)-6-oxohexoxy]pyrimidin-4-yl]oxyhexanamide (PubChem CID 90073888) has the molecular formula C18H30N4O6 and a molecular weight of 398.46 g/mol. Its IUPAC name is N-methoxy-6-[2-[6-(methoxyamino)-6-oxohexoxy]pyrimidin-4-yl]oxyhexanamide.
| Compound Name | N-methoxy-6-[2-[6-(methoxyamino)-6-oxohexoxy]pyrimidin-4-yl]oxyhexanamide |
|---|---|
| PubChem CID | 90073888 |
| Molecular Formula | C18H30N4O6 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | N-methoxy-6-[2-[6-(methoxyamino)-6-oxohexoxy]pyrimidin-4-yl]oxyhexanamide |
| SMILES | CONC(=O)CCCCCOc1ccnc(OCCCCCC(=O)NOC)n1 |
| InChI | InChI=1S/C18H30N4O6/c1-25-21-15(23)9-5-3-7-13-27-17-11-12-19-18(20-17)28-14-8-4-6-10-16(24)22-26-2/h11-12H,3-10,13-14H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | XPLGKOYCDLQFGQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|