C32H48N6O6 — CID 20512025
2-[10-[[4,6-bis[(E)-but-2-enoxy]-1,3,5-triazin-2-yl]oxy]decoxy]-4,6-bis[(E)-but-2-enoxy]-1,3,5-triazine (PubChem CID 20512025) has the molecular formula C32H48N6O6 and a molecular weight of 612.77 g/mol. Its IUPAC name is 2-[10-[[4,6-bis[(E)-but-2-enoxy]-1,3,5-triazin-2-yl]oxy]decoxy]-4,6-bis[(E)-but-2-enoxy]-1,3,5-triazine.
| Compound Name | 2-[10-[[4,6-bis[(E)-but-2-enoxy]-1,3,5-triazin-2-yl]oxy]decoxy]-4,6-bis[(E)-but-2-enoxy]-1,3,5-triazine |
|---|---|
| PubChem CID | 20512025 |
| Molecular Formula | C32H48N6O6 |
| Molecular Weight | 612.77 g/mol |
| Exact Mass | 612.36 |
| IUPAC Name | 2-[10-[[4,6-bis[(E)-but-2-enoxy]-1,3,5-triazin-2-yl]oxy]decoxy]-4,6-bis[(E)-but-2-enoxy]-1,3,5-triazine |
| SMILES | C/C=C/COc1nc(OC/C=C/C)nc(OCCCCCCCCCCOc2nc(OC/C=C/C)nc(OC/C=C/C)n2)n1 |
| InChI | InChI=1S/C32H48N6O6/c1-5-9-21-39-27-33-28(40-22-10-6-2)36-31(35-27)43-25-19-17-15-13-14-16-18-20-26-44-32-37-29(41-23-11-7-3)34-30(38-32)42-24-12-8-4/h5-12H,13-26H2,1-4H3/b9-5+,10-6+,11-7+,12-8+ |
| InChIKey | SJGFDFJFBUXFEK-HFBXSBKTSA-N |
| XLogP | 6.45 |
| TPSA | 132.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.77 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|