C16H27N3O2 — CID 175353487
2-decoxy-4-prop-2-enoxy-1,3,5-triazine (PubChem CID 175353487) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is 2-decoxy-4-prop-2-enoxy-1,3,5-triazine.
| Compound Name | 2-decoxy-4-prop-2-enoxy-1,3,5-triazine |
|---|---|
| PubChem CID | 175353487 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 2-decoxy-4-prop-2-enoxy-1,3,5-triazine |
| SMILES | C=CCOc1ncnc(OCCCCCCCCCC)n1 |
| InChI | InChI=1S/C16H27N3O2/c1-3-5-6-7-8-9-10-11-13-21-16-18-14-17-15(19-16)20-12-4-2/h4,14H,2-3,5-13H2,1H3 |
| InChIKey | TVJRTOVXUVMMBG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|