C12H18BrN5O5 — CID 142765250
2-[bromo(dinitro)methyl]-4-octoxy-1,3,5-triazine (PubChem CID 142765250) has the molecular formula C12H18BrN5O5 and a molecular weight of 392.21 g/mol. Its IUPAC name is 2-[bromo(dinitro)methyl]-4-octoxy-1,3,5-triazine.
| Compound Name | 2-[bromo(dinitro)methyl]-4-octoxy-1,3,5-triazine |
|---|---|
| PubChem CID | 142765250 |
| Molecular Formula | C12H18BrN5O5 |
| Molecular Weight | 392.21 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 2-[bromo(dinitro)methyl]-4-octoxy-1,3,5-triazine |
| SMILES | CCCCCCCCOc1ncnc(C(Br)([N+](=O)[O-])[N+](=O)[O-])n1 |
| InChI | InChI=1S/C12H18BrN5O5/c1-2-3-4-5-6-7-8-23-11-15-9-14-10(16-11)12(13,17(19)20)18(21)22/h9H,2-8H2,1H3 |
| InChIKey | RKYLRFZNJNYFND-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 134.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.21 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|