C9H9N3O3 — CID 175149649
(4-prop-2-enoxy-1,3,5-triazin-2-yl) prop-2-enoate (PubChem CID 175149649) has the molecular formula C9H9N3O3 and a molecular weight of 207.19 g/mol. Its IUPAC name is (4-prop-2-enoxy-1,3,5-triazin-2-yl) prop-2-enoate.
| Compound Name | (4-prop-2-enoxy-1,3,5-triazin-2-yl) prop-2-enoate |
|---|---|
| PubChem CID | 175149649 |
| Molecular Formula | C9H9N3O3 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | (4-prop-2-enoxy-1,3,5-triazin-2-yl) prop-2-enoate |
| SMILES | C=CCOc1ncnc(OC(=O)C=C)n1 |
| InChI | InChI=1S/C9H9N3O3/c1-3-5-14-8-10-6-11-9(12-8)15-7(13)4-2/h3-4,6H,1-2,5H2 |
| InChIKey | IMGJYBHBBXRPFT-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 74.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|