C21H27N3O7 — CID 70588479
bis(prop-2-enyl) propanedioate;2,4,6-tris(prop-2-enoxy)-1,3,5-triazine (PubChem CID 70588479) has the molecular formula C21H27N3O7 and a molecular weight of 433.46 g/mol. Its IUPAC name is bis(prop-2-enyl) propanedioate;2,4,6-tris(prop-2-enoxy)-1,3,5-triazine.
| Compound Name | bis(prop-2-enyl) propanedioate;2,4,6-tris(prop-2-enoxy)-1,3,5-triazine |
|---|---|
| PubChem CID | 70588479 |
| Molecular Formula | C21H27N3O7 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | bis(prop-2-enyl) propanedioate;2,4,6-tris(prop-2-enoxy)-1,3,5-triazine |
| SMILES | C=CCOC(=O)CC(=O)OCC=C.C=CCOc1nc(OCC=C)nc(OCC=C)n1 |
| InChI | InChI=1S/C12H15N3O3.C9H12O4/c1-4-7-16-10-13-11(17-8-5-2)15-12(14-10)18-9-6-3;1-3-5-12-8(10)7-9(11)13-6-4-2/h4-6H,1-3,7-9H2;3-4H,1-2,5-7H2 |
| InChIKey | BUNCWLFCDKQLPU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 118.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|