C19H30O4 — CID 174429542
bis(prop-2-enyl) propanedioate;deca-1,9-diene (PubChem CID 174429542) has the molecular formula C19H30O4 and a molecular weight of 322.45 g/mol. Its IUPAC name is bis(prop-2-enyl) propanedioate;deca-1,9-diene.
| Compound Name | bis(prop-2-enyl) propanedioate;deca-1,9-diene |
|---|---|
| PubChem CID | 174429542 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | bis(prop-2-enyl) propanedioate;deca-1,9-diene |
| SMILES | C=CCCCCCCC=C.C=CCOC(=O)CC(=O)OCC=C |
| InChI | InChI=1S/C10H18.C9H12O4/c1-3-5-7-9-10-8-6-4-2;1-3-5-12-8(10)7-9(11)13-6-4-2/h3-4H,1-2,5-10H2;3-4H,1-2,5-7H2 |
| InChIKey | IJVKLXGBXCUVQO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|