C23H34O2 — CID 154963431
prop-2-enyl (7Z,10Z,13Z,16Z)-icosa-7,10,13,16,19-pentaenoate (PubChem CID 154963431) has the molecular formula C23H34O2 and a molecular weight of 342.52 g/mol. Its IUPAC name is prop-2-enyl (7Z,10Z,13Z,16Z)-icosa-7,10,13,16,19-pentaenoate.
| Compound Name | prop-2-enyl (7Z,10Z,13Z,16Z)-icosa-7,10,13,16,19-pentaenoate |
|---|---|
| PubChem CID | 154963431 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | prop-2-enyl (7Z,10Z,13Z,16Z)-icosa-7,10,13,16,19-pentaenoate |
| SMILES | C=CC/C=C\C/C=C\C/C=C\C/C=C\CCCCCC(=O)OCC=C |
| InChI | InChI=1S/C23H34O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23(24)25-22-4-2/h3-4,6-7,9-10,12-13,15-16H,1-2,5,8,11,14,17-22H2/b7-6-,10-9-,13-12-,16-15- |
| InChIKey | FHABBAVXORIPSV-DOFZRALJSA-N |
| XLogP | 6.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|