C25H36O2 — CID 91333879
prop-2-enyl docosa-4,7,10,13,16,19-hexaenoate (PubChem CID 91333879) has the molecular formula C25H36O2 and a molecular weight of 368.56 g/mol. Its IUPAC name is prop-2-enyl docosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | prop-2-enyl docosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 91333879 |
| Molecular Formula | C25H36O2 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | prop-2-enyl docosa-4,7,10,13,16,19-hexaenoate |
| SMILES | C=CCOC(=O)CCC=CCC=CCC=CCC=CCC=CCC=CCC |
| InChI | InChI=1S/C25H36O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-25(26)27-24-4-2/h4-6,8-9,11-12,14-15,17-18,20-21H,2-3,7,10,13,16,19,22-24H2,1H3 |
| InChIKey | INAGFZQMCJBIFK-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|