C9H14N4O2 — CID 80868544
N-ethyl-4-methoxy-6-prop-2-enoxy-1,3,5-triazin-2-amine (PubChem CID 80868544) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is N-ethyl-4-methoxy-6-prop-2-enoxy-1,3,5-triazin-2-amine.
| Compound Name | N-ethyl-4-methoxy-6-prop-2-enoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80868544 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | N-ethyl-4-methoxy-6-prop-2-enoxy-1,3,5-triazin-2-amine |
| SMILES | C=CCOc1nc(NCC)nc(OC)n1 |
| InChI | InChI=1S/C9H14N4O2/c1-4-6-15-9-12-7(10-5-2)11-8(13-9)14-3/h4H,1,5-6H2,2-3H3,(H,10,11,12,13) |
| InChIKey | YPUJSXUPLKGOCP-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|