C14H22N4O2 — CID 80867873
N-ethyl-4-methoxy-6-[(6-methylcyclohex-3-en-1-yl)methoxy]-1,3,5-triazin-2-amine (PubChem CID 80867873) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is N-ethyl-4-methoxy-6-[(6-methylcyclohex-3-en-1-yl)methoxy]-1,3,5-triazin-2-amine.
| Compound Name | N-ethyl-4-methoxy-6-[(6-methylcyclohex-3-en-1-yl)methoxy]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80867873 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | N-ethyl-4-methoxy-6-[(6-methylcyclohex-3-en-1-yl)methoxy]-1,3,5-triazin-2-amine |
| SMILES | CCNc1nc(OC)nc(OCC2CC=CCC2C)n1 |
| InChI | InChI=1S/C14H22N4O2/c1-4-15-12-16-13(19-3)18-14(17-12)20-9-11-8-6-5-7-10(11)2/h5-6,10-11H,4,7-9H2,1-3H3,(H,15,16,17,18) |
| InChIKey | ZXKMSQQXWFLHCE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|