C24H33N3O9 — CID 67378177
7-[[4,6-bis(6-carboxyhex-5-enoxy)-1,3,5-triazin-2-yl]oxy]hept-2-enoic acid (PubChem CID 67378177) has the molecular formula C24H33N3O9 and a molecular weight of 507.54 g/mol. Its IUPAC name is 7-[[4,6-bis(6-carboxyhex-5-enoxy)-1,3,5-triazin-2-yl]oxy]hept-2-enoic acid.
| Compound Name | 7-[[4,6-bis(6-carboxyhex-5-enoxy)-1,3,5-triazin-2-yl]oxy]hept-2-enoic acid |
|---|---|
| PubChem CID | 67378177 |
| Molecular Formula | C24H33N3O9 |
| Molecular Weight | 507.54 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | 7-[[4,6-bis(6-carboxyhex-5-enoxy)-1,3,5-triazin-2-yl]oxy]hept-2-enoic acid |
| SMILES | O=C(O)C=CCCCCOc1nc(OCCCCC=CC(=O)O)nc(OCCCCC=CC(=O)O)n1 |
| InChI | InChI=1S/C24H33N3O9/c28-19(29)13-7-1-4-10-16-34-22-25-23(35-17-11-5-2-8-14-20(30)31)27-24(26-22)36-18-12-6-3-9-15-21(32)33/h7-9,13-15H,1-6,10-12,16-18H2,(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | WHZRTIBFEKHJLB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 178.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.54 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|