12-pyridin-2-yloxydodeca-2,4-dienoic acid

C17H23NO3 — CID 88522953

IUPAC12-pyridin-2-yloxydodeca-2,4-dienoic acid
SMILESO=C(O)C=CC=CCCCCCCCOc1ccccn1
InChIInChI=1S/C17H23NO3/c19-17(20)13-8-6-4-2-1-3-5-7-11-15-21-16-12-9-10-14-18-16/h4,6,8-10,12-14H,1-3,5,7,11,15H2,(H,19,20)
InChIKeyQIMCQPQDPVAVAL-UHFFFAOYSA-N
MW289.38 g/mol
LogP4.00
Rot. Bonds11

About 12-pyridin-2-yloxydodeca-2,4-dienoic acid

12-pyridin-2-yloxydodeca-2,4-dienoic acid (PubChem CID 88522953) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 12-pyridin-2-yloxydodeca-2,4-dienoic acid.

Molecular Properties

Compound Name12-pyridin-2-yloxydodeca-2,4-dienoic acid
PubChem CID88522953
Molecular FormulaC17H23NO3
Molecular Weight289.38 g/mol
Exact Mass289.17
IUPAC Name12-pyridin-2-yloxydodeca-2,4-dienoic acid
SMILESO=C(O)C=CC=CCCCCCCCOc1ccccn1
InChIInChI=1S/C17H23NO3/c19-17(20)13-8-6-4-2-1-3-5-7-11-15-21-16-12-9-10-14-18-16/h4,6,8-10,12-14H,1-3,5,7,11,15H2,(H,19,20)
InChIKeyQIMCQPQDPVAVAL-UHFFFAOYSA-N
XLogP4.00
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds11
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.38
LogP ≤ 54.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 12-pyridin-2-yloxydodeca-2,4-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 12-pyridin-2-yloxydodeca-2,4-dienoic acid?
The IUPAC name of 12-pyridin-2-yloxydodeca-2,4-dienoic acid (CID 88522953) is 12-pyridin-2-yloxydodeca-2,4-dienoic acid.
What is the SMILES notation for 12-pyridin-2-yloxydodeca-2,4-dienoic acid?
The canonical SMILES for 12-pyridin-2-yloxydodeca-2,4-dienoic acid is O=C(O)C=CC=CCCCCCCCOc1ccccn1.
What is the InChIKey of 12-pyridin-2-yloxydodeca-2,4-dienoic acid?
The InChIKey is QIMCQPQDPVAVAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO3/c19-17(20)13-8-6-4-2-1-3-5-7-11-15-21-16-12-9-10-14-18-16/h4,6,8-10,12-14H,1-3,5,7,11,15H2,(H,19,20).
What are the key properties of 12-pyridin-2-yloxydodeca-2,4-dienoic acid?
12-pyridin-2-yloxydodeca-2,4-dienoic acid has a molecular weight of 289.38 g/mol, XLogP of 4.00, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 12-pyridin-2-yloxydodeca-2,4-dienoic acid is sourced from PubChem (CID 88522953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).