C19H32O4 — CID 87405159
(2E,4E)-nonadeca-2,4-dienedioic acid (PubChem CID 87405159) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is (2E,4E)-nonadeca-2,4-dienedioic acid.
| Compound Name | (2E,4E)-nonadeca-2,4-dienedioic acid |
|---|---|
| PubChem CID | 87405159 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | (2E,4E)-nonadeca-2,4-dienedioic acid |
| SMILES | O=C(O)/C=C/C=C/CCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C19H32O4/c20-18(21)16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-17-19(22)23/h10,12,14,16H,1-9,11,13,15,17H2,(H,20,21)(H,22,23)/b12-10+,16-14+ |
| InChIKey | UPXZQRFCEDBVQW-PQSJUVMFSA-N |
| XLogP | 5.34 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|