nonadeca-2,4,6-trienedioic acid

C19H30O4 — CID 123861344

IUPACnonadeca-2,4,6-trienedioic acid
SMILESO=C(O)C=CC=CC=CCCCCCCCCCCCC(=O)O
InChIInChI=1S/C19H30O4/c20-18(21)16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-17-19(22)23/h6,8,10,12,14,16H,1-5,7,9,11,13,15,17H2,(H,20,21)(H,22,23)
InChIKeyJOGZVGNFJOZGPX-UHFFFAOYSA-N
MW322.44 g/mol
LogP5.12
Rot. Bonds15

About nonadeca-2,4,6-trienedioic acid

nonadeca-2,4,6-trienedioic acid (PubChem CID 123861344) has the molecular formula C19H30O4 and a molecular weight of 322.44 g/mol. Its IUPAC name is nonadeca-2,4,6-trienedioic acid.

Molecular Properties

Compound Namenonadeca-2,4,6-trienedioic acid
PubChem CID123861344
Molecular FormulaC19H30O4
Molecular Weight322.44 g/mol
Exact Mass322.21
IUPAC Namenonadeca-2,4,6-trienedioic acid
SMILESO=C(O)C=CC=CC=CCCCCCCCCCCCC(=O)O
InChIInChI=1S/C19H30O4/c20-18(21)16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-17-19(22)23/h6,8,10,12,14,16H,1-5,7,9,11,13,15,17H2,(H,20,21)(H,22,23)
InChIKeyJOGZVGNFJOZGPX-UHFFFAOYSA-N
XLogP5.12
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds15
Heavy Atoms23
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500322.44
LogP ≤ 55.12
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze nonadeca-2,4,6-trienedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of nonadeca-2,4,6-trienedioic acid?
The IUPAC name of nonadeca-2,4,6-trienedioic acid (CID 123861344) is nonadeca-2,4,6-trienedioic acid.
What is the SMILES notation for nonadeca-2,4,6-trienedioic acid?
The canonical SMILES for nonadeca-2,4,6-trienedioic acid is O=C(O)C=CC=CC=CCCCCCCCCCCCC(=O)O.
What is the InChIKey of nonadeca-2,4,6-trienedioic acid?
The InChIKey is JOGZVGNFJOZGPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30O4/c20-18(21)16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-17-19(22)23/h6,8,10,12,14,16H,1-5,7,9,11,13,15,17H2,(H,20,21)(H,22,23).
What are the key properties of nonadeca-2,4,6-trienedioic acid?
nonadeca-2,4,6-trienedioic acid has a molecular weight of 322.44 g/mol, XLogP of 5.12, 15 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for nonadeca-2,4,6-trienedioic acid is sourced from PubChem (CID 123861344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).