C19H30O4 — CID 123861344
nonadeca-2,4,6-trienedioic acid (PubChem CID 123861344) has the molecular formula C19H30O4 and a molecular weight of 322.44 g/mol. Its IUPAC name is nonadeca-2,4,6-trienedioic acid.
| Compound Name | nonadeca-2,4,6-trienedioic acid |
|---|---|
| PubChem CID | 123861344 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | nonadeca-2,4,6-trienedioic acid |
| SMILES | O=C(O)C=CC=CC=CCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C19H30O4/c20-18(21)16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-17-19(22)23/h6,8,10,12,14,16H,1-5,7,9,11,13,15,17H2,(H,20,21)(H,22,23) |
| InChIKey | JOGZVGNFJOZGPX-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|