C28H44O4 — CID 12073778
(10E,12E,14E,16E,18E)-octacosa-10,12,14,16,18-pentaenedioic acid (PubChem CID 12073778) has the molecular formula C28H44O4 and a molecular weight of 444.66 g/mol. Its IUPAC name is (10E,12E,14E,16E,18E)-octacosa-10,12,14,16,18-pentaenedioic acid.
| Compound Name | (10E,12E,14E,16E,18E)-octacosa-10,12,14,16,18-pentaenedioic acid |
|---|---|
| PubChem CID | 12073778 |
| Molecular Formula | C28H44O4 |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.32 |
| IUPAC Name | (10E,12E,14E,16E,18E)-octacosa-10,12,14,16,18-pentaenedioic acid |
| SMILES | O=C(O)CCCCCCCC/C=C/C=C/C=C/C=C/C=C/CCCCCCCCC(=O)O |
| InChI | InChI=1S/C28H44O4/c29-27(30)25-23-21-19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20-22-24-26-28(31)32/h1-10H,11-26H2,(H,29,30)(H,31,32)/b2-1+,5-3+,6-4+,9-7+,10-8+ |
| InChIKey | BTWMLXGZJLGGRP-CLQTYQDTSA-N |
| XLogP | 8.18 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|