C18H26O4 — CID 87404974
(2E,4E,6E,8E)-octadeca-2,4,6,8-tetraenedioic acid (PubChem CID 87404974) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is (2E,4E,6E,8E)-octadeca-2,4,6,8-tetraenedioic acid.
| Compound Name | (2E,4E,6E,8E)-octadeca-2,4,6,8-tetraenedioic acid |
|---|---|
| PubChem CID | 87404974 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (2E,4E,6E,8E)-octadeca-2,4,6,8-tetraenedioic acid |
| SMILES | O=C(O)/C=C/C=C/C=C/C=C/CCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H26O4/c19-17(20)15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18(21)22/h1,3,5,7,9,11,13,15H,2,4,6,8,10,12,14,16H2,(H,19,20)(H,21,22)/b3-1+,7-5+,11-9+,15-13+ |
| InChIKey | HNAZKYQYIXEEAS-IJGJQPSKSA-N |
| XLogP | 4.50 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|