C14H20O4 — CID 123267309
tetradeca-2,4,6-trienedioic acid (PubChem CID 123267309) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is tetradeca-2,4,6-trienedioic acid.
| Compound Name | tetradeca-2,4,6-trienedioic acid |
|---|---|
| PubChem CID | 123267309 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | tetradeca-2,4,6-trienedioic acid |
| SMILES | O=C(O)C=CC=CC=CCCCCCCC(=O)O |
| InChI | InChI=1S/C14H20O4/c15-13(16)11-9-7-5-3-1-2-4-6-8-10-12-14(17)18/h1,3,5,7,9,11H,2,4,6,8,10,12H2,(H,15,16)(H,17,18) |
| InChIKey | CVHUJHRMKXFMIX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|